CymitQuimica logo

CAS 1151863-10-3

:

Hexanoic acid, 3-amino-4-methyl-, (3S)-

Description:
Hexanoic acid, 3-amino-4-methyl-, (3S)-, is an organic compound characterized by its carboxylic acid functional group and an amino group attached to a hexanoic acid backbone. The presence of the amino group at the 3-position and a methyl group at the 4-position contributes to its chiral nature, with the (3S) designation indicating the specific stereochemistry of the molecule. This compound is likely to exhibit properties typical of both amino acids and fatty acids, such as solubility in polar solvents and potential for forming hydrogen bonds. It may participate in various biochemical processes, including serving as a building block for peptides or other derivatives. The molecular structure suggests it could have applications in pharmaceuticals, agrochemicals, or as a biochemical reagent. Its specific interactions and reactivity would depend on the surrounding conditions, such as pH and temperature, as well as the presence of other functional groups in a given reaction environment.
Formula:C7H15NO2
InChI:InChI=1S/C7H15NO2/c1-3-5(2)6(8)4-7(9)10/h5-6H,3-4,8H2,1-2H3,(H,9,10)/t5?,6-/m0/s1
InChI key:InChIKey=JHEDYGILOIBOTL-GDVGLLTNSA-N
SMILES:[C@@H](C(CC)C)(CC(O)=O)N
Synonyms:
  • Hexanoic acid, 3-amino-4-methyl-, (3S)-
  • (3s)-3-Amino-4-methylhexanoic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.