CymitQuimica logo

CAS 1151942-85-6

:

Chryseno[2,1-f]isoquinolinium, 10-(dibutylamino)-2-[3-(trimethylammonio)propyl]-, bromide (1:2)

Description:
Chryseno[2,1-f]isoquinolinium, 10-(dibutylamino)-2-[3-(trimethylammonio)propyl]-, bromide (1:2) is a quaternary ammonium compound characterized by its complex structure, which includes a chrysene-derived isoquinolinium core. This compound features a dibutylamino group and a trimethylammonio propyl substituent, contributing to its amphiphilic nature. The presence of bromide ions indicates that it is a salt, which can influence its solubility and stability in various solvents. Typically, such compounds exhibit interesting photophysical properties, making them useful in applications like fluorescence imaging and as potential probes in biological systems. The quaternary ammonium structure often imparts cationic characteristics, which can enhance interactions with negatively charged biological membranes or other anionic species. Additionally, the compound's unique structural features may lead to specific reactivity patterns, making it a subject of interest in synthetic organic chemistry and materials science. Overall, its properties are influenced by both its molecular structure and the presence of the bromide counterion.
Formula:C39H47N3·2Br
InChI:InChI=1S/C39H47N3.2BrH/c1-6-8-23-41(24-9-7-2)31-13-16-32-29(27-31)11-14-36-34(32)17-19-39-37-15-12-30-28-40(22-10-26-42(3,4)5)25-21-33(30)35(37)18-20-38(36)39;;/h11-21,25,27-28H,6-10,22-24,26H2,1-5H3;2*1H/q+2;;/p-2
InChI key:InChIKey=LGXPDFMRHWKUGJ-UHFFFAOYSA-L
SMILES:N(CCCC)(CCCC)C1=CC=2C(=C3C(C4=C(C=5C(C=C4)=C6C(=CC5)C=[N+](CCC[N+](C)(C)C)C=C6)C=C3)=CC2)C=C1.[Br-]
Synonyms:
  • Annine 6 plus
  • Chryseno[2,1-f]isoquinolinium, 10-(dibutylamino)-2-[3-(trimethylammonio)propyl]-, bromide (1:2)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.