CAS 1152-14-3
:resorufin acetate
Description:
Resorufin acetate, with the CAS number 1152-14-3, is a chemical compound that serves as a fluorescent dye and is widely used in biochemical assays, particularly for monitoring cellular activity and viability. It is a derivative of resorufin, which is known for its bright fluorescence and is often employed in various applications, including as a substrate for enzymes like dehydrogenases. The acetate group in resorufin acetate enhances its solubility and stability in biological systems. This compound exhibits a characteristic absorption and emission spectrum, making it suitable for fluorescence-based detection methods. Resorufin acetate is typically non-toxic and can be converted into resorufin in the presence of certain enzymes, allowing for the quantification of enzymatic activity. Its properties make it valuable in research fields such as pharmacology, toxicology, and cell biology, where it aids in the assessment of metabolic processes and cellular responses to various stimuli.
Formula:C14H11NO5
InChI:InChI=1/C12H7NO3.C2H4O2/c14-7-1-3-9-11(5-7)16-12-6-8(15)2-4-10(12)13-9;1-2(3)4/h1-6,14H;1H3,(H,3,4)
SMILES:c1cc2c(cc1O)oc1cc(=O)ccc1n2.CC(=O)O
Synonyms:- 7-Acetoxy-3H-phenoxazin-3-one
- 3H-Phenoxazin-3-one, 7-(acetyloxy)-
- 3-oxo-3H-phenoxazin-7-yl acetate
- 7-hydroxy-3H-phenoxazin-3-one acetate (1:1)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
3H-Phenoxazin-3-one, 7-(acetyloxy)-
CAS:Formula:C14H9NO4Purity:98%Color and Shape:SolidMolecular weight:255.2256Resorufin acetate
CAS:Resorufin acetate is a fluorogenic substrate for esterase activity measurments in lipid metabolism studies. It is also used as a substrate for chymotrypsin, a digestive enzyme produced by the pancreas that aids in protein digestion in the small intestine.
Formula:C14H9NO4Purity:Min. 95%Color and Shape:PowderMolecular weight:255.23 g/mol



