CAS 1152-31-4

2-[2-(4-Pyridinylcarbonyl)hydrazinylidene]pentanedioic acid

Description:

2-[2-(4-Pyridinylcarbonyl)hydrazinylidene]pentanedioic acid, with the CAS number 1152-31-4, is a chemical compound characterized by its complex structure, which includes a hydrazine moiety and a pyridine ring. This compound features a pentanedioic acid backbone, indicating the presence of two carboxylic acid functional groups, which contribute to its acidity and potential for forming salts or esters. The hydrazinylidene group introduces reactivity, particularly in condensation reactions, while the pyridinylcarbonyl substituent can enhance the compound's ability to participate in various chemical interactions, including hydrogen bonding and coordination with metal ions. The presence of these functional groups suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals. Additionally, the compound's structural features may influence its solubility, stability, and reactivity, making it a subject of interest in synthetic organic chemistry and materials science. Overall, this compound exemplifies the intricate interplay of functional groups that can dictate the chemical behavior and potential applications of organic molecules.

Formula: C₁₁H₁₁N₃O₅

InChI: InChI=1S/C11H11N3O5/c15-9(16)2-1-8(11(18)19)13-14-10(17)7-3-5-12-6-4-7/h3-6H,1-2H2,(H,14,17)(H,15,16)(H,18,19)

InChI key: InChIKey=CCBSJXHUMYNUKH-UHFFFAOYSA-N

SMILES: C(NN=C(CCC(O)=O)C(O)=O)(=O)C=1C=CN=CC1

Synonyms:

• Pentanedioic acid, 2-[(4-pyridinylcarbonyl)hydrazono]-
• Glutaric acid, 2-oxo-, 2-(isonicotinoylhydrazone)
• Hydrazine, 1-(1,3-dicarboxypropylidene)-2-isonicotinoyl-
• Glutaric acid, 2-oxo-, isonicotinoylhydrazone
• Pentanedioic acid, 2-[2-(4-pyridinylcarbonyl)hydrazinylidene]-

Pentanedioic acid, 2-[2-(4-pyridinylcarbonyl)hydrazinylidene]-

CAS: 1152-31-4

Formula: C₁₁H₁₁N₃O₅

Molecular weight: 265.2221

Ref: IN-DA000GF3