CAS 1152-75-6
:N,N′-Bis(4-methoxyphenyl)methanimidamide
Description:
N,N′-Bis(4-methoxyphenyl)methanimidamide, with the CAS number 1152-75-6, is an organic compound characterized by its structure, which features two 4-methoxyphenyl groups attached to a central methanimidamide moiety. This compound typically exhibits properties associated with amides, including potential solubility in organic solvents and moderate stability under standard conditions. The presence of methoxy groups enhances its electron-donating characteristics, which can influence its reactivity and interaction with other chemical species. N,N′-Bis(4-methoxyphenyl)methanimidamide may also display biological activity, making it of interest in medicinal chemistry and pharmaceutical research. Its molecular structure allows for potential applications in various fields, including organic synthesis and material science. However, specific physical properties such as melting point, boiling point, and solubility can vary and should be referenced from reliable chemical databases or literature for precise information. Overall, this compound represents a versatile structure with potential implications in both academic and industrial chemistry.
Formula:C15H16N2O2
InChI:InChI=1S/C15H16N2O2/c1-18-14-7-3-12(4-8-14)16-11-17-13-5-9-15(19-2)10-6-13/h3-11H,1-2H3,(H,16,17)
InChI key:InChIKey=CVPWVOGLBRAKHX-UHFFFAOYSA-N
SMILES:N(=CNC1=CC=C(OC)C=C1)C2=CC=C(OC)C=C2
Synonyms:- N,N′-Bis(4-methoxyphenyl)formamidine
- Methanimidamide, N,N′-bis(4-methoxyphenyl)-
- N,N′-Bis(4-methoxyphenyl)methanimidamide
- N,N′-Bis(p-methoxyphenyl)formamidine
- Formamidine, N,N′-bis(p-methoxyphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
