CAS 115200-30-1
:2-(3,4-dichlorophenyl)-N-[1-(3,4-dimethoxyphenyl)-2-pyrrolidin-1-ylethyl]-N-methylacetamide hydrochloride
Description:
2-(3,4-Dichlorophenyl)-N-[1-(3,4-dimethoxyphenyl)-2-pyrrolidin-1-ylethyl]-N-methylacetamide hydrochloride, with CAS number 115200-30-1, is a synthetic compound characterized by its complex molecular structure, which includes a dichlorophenyl group and a pyrrolidine moiety. This compound is typically classified as a pharmaceutical agent and may exhibit properties relevant to its potential therapeutic applications. The presence of multiple functional groups, including amide and ether linkages, suggests that it may engage in various interactions with biological targets. Its hydrochloride salt form indicates enhanced solubility in aqueous environments, which is often advantageous for drug formulation. The compound's specific pharmacological effects, mechanisms of action, and safety profile would require detailed investigation through experimental studies. Additionally, its synthesis and characterization would involve standard organic chemistry techniques, including purification methods such as crystallization or chromatography. Overall, this compound represents a class of molecules that may hold significance in medicinal chemistry and drug development.
Formula:C23H29Cl3N2O3
InChI:InChI=1/C23H28Cl2N2O3.ClH/c1-26(23(28)13-16-6-8-18(24)19(25)12-16)20(15-27-10-4-5-11-27)17-7-9-21(29-2)22(14-17)30-3;/h6-9,12,14,20H,4-5,10-11,13,15H2,1-3H3;1H
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
ICI-204879 HCl
CAS:ICI-204879 HCl is a potent and selective agonists at the opioid kappa-receptor.Formula:C23H29Cl3N2O3Color and Shape:SolidMolecular weight:487.85
