CAS 1152088-81-7

3-Iodo-2-methylbenzenemethanamine

Description:

3-Iodo-2-methylbenzenemethanamine, identified by its CAS number 1152088-81-7, is an organic compound that features a benzene ring substituted with both an iodine atom and a methyl group, along with an amine functional group. This compound is characterized by its aromatic structure, which contributes to its stability and potential reactivity. The presence of the iodine atom introduces unique properties, such as increased molecular weight and potential for halogen-related reactivity, including nucleophilic substitution reactions. The methyl group enhances the hydrophobic character of the molecule, influencing its solubility in organic solvents. Additionally, the amine group can participate in hydrogen bonding, affecting the compound's interactions with other molecules. Overall, 3-Iodo-2-methylbenzenemethanamine may be of interest in various fields, including medicinal chemistry and materials science, due to its potential applications in drug development and synthesis of novel compounds. However, specific safety and handling guidelines should be followed, as with all chemical substances.

Formula: C₈H₁₀IN

InChI: InChI=1S/C8H10IN/c1-6-7(5-10)3-2-4-8(6)9/h2-4H,5,10H2,1H3

InChI key: InChIKey=RSDFQGWYVYLGNA-UHFFFAOYSA-N

SMILES: C(N)C1=C(C)C(I)=CC=C1

Synonyms:

• 3-Iodo-2-methylbenzenemethanamine
• 3-Iodo-2-methylbenzylamine
• Benzenemethanamine, 3-iodo-2-methyl-