CAS 1152110-31-0

(2R)-2-Amino-1-(1-pyrrolidinyl)-1-propanone

Description:

(2R)-2-Amino-1-(1-pyrrolidinyl)-1-propanone, also known by its chemical structure, is a chiral compound characterized by the presence of an amino group and a pyrrolidine ring. This substance typically exhibits properties associated with amines and ketones, including basicity due to the amino group and potential reactivity due to the carbonyl functionality. The pyrrolidine moiety contributes to its cyclic structure, influencing its steric and electronic properties. As a chiral molecule, it can exist in two enantiomeric forms, which may exhibit different biological activities or pharmacological effects. This compound is of interest in medicinal chemistry and may be studied for its potential applications in drug development or as a research chemical. Its solubility, stability, and reactivity can vary based on environmental conditions such as pH and temperature. Safety data and handling precautions should be considered, as with any chemical substance, particularly in laboratory or industrial settings.

Formula: C₇H₁₄N₂O

InChI: InChI=1S/C7H14N2O/c1-6(8)7(10)9-4-2-3-5-9/h6H,2-5,8H2,1H3/t6-/m1/s1

InChI key: InChIKey=IVBVTDXOGUNDHC-ZCFIWIBFSA-N

SMILES: C([C@@H](C)N)(=O)N1CCCC1

Synonyms:

• (2R)-2-Amino-1-(1-pyrrolidinyl)-1-propanone
• (R)-2-Amino-1-(pyrrolidin-1-yl)propan-1-one
• (2R)-2-Amino-1-(pyrrolidin-1-yl)propan-1-one
• 1-Propanone, 2-amino-1-(1-pyrrolidinyl)-, (2R)-