
CAS 1152110-34-3
:(2S)-2-Amino-1-(1-pyrrolidinyl)-1-butanone
Description:
(2S)-2-Amino-1-(1-pyrrolidinyl)-1-butanone, identified by its CAS number 1152110-34-3, is a chemical compound characterized by its amino and ketone functional groups. This substance features a chiral center, which contributes to its stereochemistry, specifically the (2S) configuration indicating its specific spatial arrangement. The presence of a pyrrolidine ring enhances its potential for biological activity, making it of interest in medicinal chemistry and pharmacology. The compound is typically a solid at room temperature and is soluble in polar solvents due to its amino and carbonyl groups, which can engage in hydrogen bonding. Its structural features suggest potential applications in the synthesis of pharmaceuticals or as a building block in organic synthesis. Additionally, the compound's properties may include moderate stability under standard conditions, but it could be sensitive to extreme pH levels or reactive agents. As with many amino compounds, it may exhibit basicity due to the amino group, influencing its reactivity and interactions in various chemical environments.
Formula:C8H16N2O
InChI:InChI=1S/C8H16N2O/c1-2-7(9)8(11)10-5-3-4-6-10/h7H,2-6,9H2,1H3/t7-/m0/s1
InChI key:InChIKey=LSMYTQPMEHMSCJ-ZETCQYMHSA-N
SMILES:C([C@H](CC)N)(=O)N1CCCC1
Synonyms:- 1-Butanone, 2-amino-1-(1-pyrrolidinyl)-, (2S)-
- (2S)-2-Amino-1-(1-pyrrolidinyl)-1-butanone
- (2S)-2-Amino-1-(pyrrolidin-1-yl)butan-1-one
- (S)-1-((Pyrrolidin-1-yl)carbonyl)propylamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.