CAS 1152113-32-0

1-Piperidinecarboxylic acid, 3-amino-, 1,1-dimethylethyl ester, hydrochloride (1:1), (3R)-

Description:

1-Piperidinecarboxylic acid, 3-amino-, 1,1-dimethylethyl ester, hydrochloride (1:1), (3R)- is a chemical compound characterized by its piperidine ring structure, which is a six-membered nitrogen-containing heterocycle. This compound features a carboxylic acid moiety and an amino group, contributing to its potential as a bioactive molecule. The presence of the 1,1-dimethylethyl ester indicates that it has a bulky substituent, which may influence its solubility and reactivity. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form, making it suitable for various applications, including pharmaceutical formulations. The (3R)- designation indicates the specific stereochemistry at the chiral center, which can significantly affect the compound's biological activity and interaction with receptors. Overall, this compound may exhibit properties relevant to medicinal chemistry, particularly in the development of therapeutic agents.

Formula: C₁₀H₂₀N₂O₂·ClH

InChI: InChI=1S/C10H20N2O2.ClH/c1-10(2,3)14-9(13)12-6-4-5-8(11)7-12;/h8H,4-7,11H2,1-3H3;1H/t8-;/m1./s1

InChI key: InChIKey=DUNAVVRRZJQGCZ-DDWIOCJRSA-N

SMILES: C(OC(C)(C)C)(=O)N1C[C@H](N)CCC1.Cl

Synonyms:

• 1-Piperidinecarboxylic acid, 3-amino-, 1,1-dimethylethyl ester, hydrochloride (1:1), (3R)-
• (R)-3-Amino-1-Boc-piperidine hydrochloride