CAS 115217-60-2
:Dimethyl methyldopa HCL
Description:
Dimethyl methyldopa hydrochloride, identified by the CAS number 115217-60-2, is a chemical compound that serves as an antihypertensive agent. It is a derivative of methyldopa, which is commonly used to manage high blood pressure, particularly in pregnant women. The compound features a dimethylamino group, which contributes to its pharmacological activity. As a hydrochloride salt, it is typically more soluble in water, enhancing its bioavailability. Dimethyl methyldopa acts primarily as a centrally acting alpha-2 adrenergic agonist, leading to a reduction in sympathetic outflow and a subsequent decrease in blood pressure. Its chemical structure includes a carboxylic acid group, which is crucial for its interaction with biological systems. The compound is generally administered orally and is characterized by its stability under standard storage conditions. Safety and efficacy profiles are well-documented, making it a valuable option in the therapeutic management of hypertension. However, like all medications, it may have side effects and contraindications that should be considered in clinical use.
Formula:C12H17NO4
InChI:InChI=1/C12H17NO4/c1-12(13,11(14)15)7-8-4-5-9(16-2)10(6-8)17-3/h4-6H,7,13H2,1-3H3,(H,14,15)
SMILES:CC(Cc1ccc(c(c1)OC)OC)(C(=O)O)N
Synonyms:- 3,4-dimethyl-l-methyldopa HCL
- Dimethyl Methyldopa Hydrochloride
- Dmmd
- Dimethoxy Methyldopa Hcl
- 3-methoxy-O,alpha-dimethyl-L-tyrosine hydrate (2:3)
- 3-methoxy-O,alpha-dimethyltyrosine
- Dimethyl Methyldopa
- DIMETHYL METHYLDOPA HCL
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
