
CAS 1152237-10-9
:7-Bromo-2-phenyl-4(3H)-quinazolinone
Description:
7-Bromo-2-phenyl-4(3H)-quinazolinone is a chemical compound characterized by its quinazolinone core structure, which features a bromine atom at the 7-position and a phenyl group at the 2-position. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to its ability to interact with various biological targets. It is often studied for its pharmacological properties, particularly in the context of medicinal chemistry, where modifications to the quinazolinone scaffold can lead to compounds with enhanced efficacy against specific diseases. The presence of the bromine atom can influence the compound's reactivity and solubility, while the phenyl group may contribute to its lipophilicity. Additionally, 7-Bromo-2-phenyl-4(3H)-quinazolinone may exhibit fluorescence properties, making it useful in various analytical applications. As with many quinazolinone derivatives, it is important to consider its stability, potential toxicity, and environmental impact during handling and application in research or pharmaceutical development.
Formula:C14H9BrN2O
InChI:InChI=1S/C14H9BrN2O/c15-10-6-7-11-12(8-10)16-13(17-14(11)18)9-4-2-1-3-5-9/h1-8H,(H,16,17,18)
InChI key:InChIKey=FUANHHNELFMMAX-UHFFFAOYSA-N
SMILES:O=C1C=2C(NC(=N1)C3=CC=CC=C3)=CC(Br)=CC2
Synonyms:- 7-Bromo-2-phenyl-4(3H)-quinazolinone
- 4(3H)-Quinazolinone, 7-bromo-2-phenyl-
- 7-Bromo-4-hydroxy-2-phenylquinazoline
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.