CAS 115238-58-9
:Decanhydroisoquinoline-3-Carboxylic Acid
Description:
Decanhydroisoquinoline-3-Carboxylic Acid, with the CAS number 115238-58-9, is a chemical compound that belongs to the class of isoquinoline derivatives. This substance features a bicyclic structure that includes a nitrogen atom within its ring system, contributing to its unique chemical properties. It is characterized by the presence of a carboxylic acid functional group, which imparts acidic properties and enhances its reactivity in various chemical reactions. The compound is typically used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or other bioactive molecules. Its solubility and stability can vary depending on the solvent and conditions used, making it important to consider these factors in practical applications. Additionally, the presence of the isoquinoline moiety suggests potential biological activity, which may warrant further investigation in medicinal chemistry. Overall, Decanhydroisoquinoline-3-Carboxylic Acid is a compound of interest in both synthetic and medicinal chemistry contexts.
Formula:C10H17NO2
InChI:InChI=1/C10H17NO2/c12-10(13)9-5-7-3-1-2-4-8(7)6-11-9/h7-9,11H,1-6H2,(H,12,13)/t7?,8?,9-/m0/s1
SMILES:C1CCC2CN[C@@H](CC2C1)C(=O)O
Synonyms:- Decahydro-Isoquinoline-3-Carboxylic Acid Hydrochloride
- Decahydro-Isoquinoline-3-Carboxylic Acid
- (3S)-decahydroisoquinoline-3-carboxylic acid
- (S,S,S)-decahydro-3-Isoquinolinecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
