CymitQuimica logo

CAS 1152427-93-4

:

(T-4)-[N-[(Carboxy-κO)methyl]-N-methylglycinato(2-)-κN,κO][(1E)-2-phenylethenyl]boron

Description:
The chemical substance known as "(T-4)-[N-[(Carboxy-κO)methyl]-N-methylglycinato(2-)-κN,κO][(1E)-2-phenylethenyl]boron" with CAS number 1152427-93-4 is a boron-containing compound that exhibits unique structural and functional characteristics. It features a boron atom coordinated to a complex ligand that includes a carboxymethyl group and a methylglycine moiety, which contribute to its potential biological activity. The presence of the (1E)-2-phenylethenyl group suggests that the compound may possess interesting electronic properties and could be involved in various chemical reactions, including those relevant to medicinal chemistry. The carboxylate functionality may enhance solubility and reactivity, while the methyl groups can influence steric hindrance and overall molecular stability. Such compounds are often studied for their applications in drug design, particularly in targeting specific biological pathways or as agents in boron neutron capture therapy (BNCT). Overall, this compound represents a fascinating intersection of organic chemistry and medicinal applications, warranting further investigation into its properties and potential uses.
Formula:C13H14BNO4
InChI:InChI=1/C13H14BNO4/c1-15-9-12(16)18-14(15,19-13(17)10-15)8-7-11-5-3-2-4-6-11/h2-8H,9-10H2,1H3
InChI key:InChIKey=MYDQIIDLLNBEIJ-UHFFFAOYNA-N
SMILES:[CH-](=CC1=CC=CC=C1)[B+3]23[N](C)(CC(=O)[O-]2)CC(=O)[O-]3
Synonyms:
  • Boron, [N-[(carboxy-κO)methyl]-N-methylglycinato(2-)-κN,κO][(1E)-2-phenylethenyl]-, (T-4)-
  • (T-4)-[N-[(Carboxy-κO)methyl]-N-methylglycinato(2-)-κN,κO][(1E)-2-phenylethenyl]boron
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.