CAS 1152427-99-0
:(T-4)-[N-[(Carboxy-κO)methyl]-N-methylglycinato(2-)-κN,κO][(1E)-2-cyclohexylethenyl]boron
Description:
The chemical substance known as "(T-4)-[N-[(Carboxy-κO)methyl]-N-methylglycinato(2-)-κN,κO][(1E)-2-cyclohexylethenyl]boron" with CAS number 1152427-99-0 is a boron-containing compound that exhibits unique structural and functional characteristics. It features a boron atom coordinated to a complex ligand system, which includes a carboxymethyl group and a methylglycine moiety. The presence of the cyclohexylethenyl group suggests potential applications in organic synthesis or medicinal chemistry, particularly in targeting specific biological pathways. The compound's coordination chemistry may allow for interactions with various biological molecules, making it of interest in drug development or as a therapeutic agent. Additionally, the carboxylate functionality may enhance solubility and reactivity in aqueous environments. Overall, this compound represents a class of boron-based ligands that could have implications in both research and practical applications, particularly in fields such as biochemistry and materials science. Further studies would be necessary to elucidate its specific properties and potential uses.
Formula:C13H20BNO4
InChI:InChI=1/C13H20BNO4/c1-15-9-12(16)18-14(15,19-13(17)10-15)8-7-11-5-3-2-4-6-11/h7-8,11H,2-6,9-10H2,1H3
InChI key:InChIKey=QPOUTQDXGMJIAD-UHFFFAOYNA-N
SMILES:[CH-](=CC1CCCCC1)[B+3]23[N](C)(CC(=O)[O-]2)CC(=O)[O-]3
Synonyms:- Boron, [N-[(carboxy-κO)methyl]-N-methylglycinato(2-)-κN,κO][(1E)-2-cyclohexylethenyl]-, (T-4)-
- (T-4)-[N-[(Carboxy-κO)methyl]-N-methylglycinato(2-)-κN,κO][(1E)-2-cyclohexylethenyl]boron
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
