CAS 1152430-27-7

1,1-Dimethylethyl N-[1-(1-oxopropyl)-4-piperidinyl]carbamate

Description:

1,1-Dimethylethyl N-[1-(1-oxopropyl)-4-piperidinyl]carbamate, identified by its CAS number 1152430-27-7, is a chemical compound that belongs to the class of carbamates. This substance features a piperidine ring, which is a six-membered nitrogen-containing heterocycle, contributing to its potential biological activity. The presence of the dimethyl group indicates steric hindrance, which may influence its reactivity and interaction with biological targets. The oxopropyl moiety suggests that the compound may participate in various chemical reactions, including those involving nucleophiles or electrophiles. Its structure implies potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the piperidine's role in enhancing solubility and bioavailability. Additionally, the carbamate functional group is known for its ability to form hydrogen bonds, which can be crucial for binding interactions in biological systems. Overall, this compound's unique structural features may confer specific pharmacological properties, warranting further investigation into its potential uses in therapeutic applications.

Formula: C₁₃H₂₄N₂O₃

InChI: InChI=1S/C13H24N2O3/c1-5-11(16)15-8-6-10(7-9-15)14-12(17)18-13(2,3)4/h10H,5-9H2,1-4H3,(H,14,17)

InChI key: InChIKey=DGSULKQLDKHQML-UHFFFAOYSA-N

SMILES: C(CC)(=O)N1CCC(NC(OC(C)(C)C)=O)CC1

Synonyms:

• (1-Propionyl-piperidin-4-yl)-carbamic acid tert-butyl ester
• 1,1-Dimethylethyl N-[1-(1-oxopropyl)-4-piperidinyl]carbamate
• Carbamic acid, N-[1-(1-oxopropyl)-4-piperidinyl]-, 1,1-dimethylethyl ester

4-(BOC-Amino)-1-propanoylpiperidine

CAS: 1152430-27-7

Formula: C₁₃H₂₄N₂O₃

Molecular weight: 256.3413

Ref: IN-DA000GHD