CymitQuimica logo

CAS 115245-14-2

:

Tricyclo[5.5.0.02,8]dodeca-3,5-diene

Description:
Tricyclo[5.5.0.02,8]dodeca-3,5-diene is a polycyclic hydrocarbon characterized by its unique tricyclic structure, which consists of a dodecane framework with two double bonds located at the 3 and 5 positions. This compound features a complex arrangement of carbon atoms that contributes to its stability and reactivity. The presence of the double bonds indicates that it can participate in various chemical reactions, such as addition reactions typical of alkenes. Its molecular structure may lead to interesting properties, including potential applications in organic synthesis and materials science. The compound is likely to be insoluble in water but soluble in organic solvents, which is common for hydrocarbons. Additionally, due to its intricate structure, it may exhibit unique optical and electronic properties, making it a subject of interest in research related to organic electronics or photonics. Safety and handling precautions should be observed, as with many organic compounds, to mitigate any potential hazards associated with its use.
Formula:C12H16
InChI:InChI=1S/C12H16/c1-2-6-10-11-7-3-4-8-12(10)9(11)5-1/h1-2,5-6,9-12H,3-4,7-8H2
InChI key:InChIKey=KQXWVCOTWFVIGF-UHFFFAOYSA-N
SMILES:C12C3C(C1C=CC=C3)CCCC2
Synonyms:
  • Tricyclo[5.5.0.02,8]dodeca-3,5-diene
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.