CAS 1152475-42-7

7-Bromo-2-chlorothieno[3,2-d]pyrimidine

Description:

7-Bromo-2-chlorothieno[3,2-d]pyrimidine is a heterocyclic compound characterized by the presence of both bromine and chlorine substituents on a fused thieno-pyrimidine ring system. This compound features a thieno ring, which is a five-membered aromatic ring containing sulfur, fused to a pyrimidine ring, a six-membered ring containing nitrogen atoms. The presence of halogens (bromine and chlorine) typically enhances the compound's reactivity, making it useful in various chemical reactions, including nucleophilic substitutions and coupling reactions. The unique structure of 7-Bromo-2-chlorothieno[3,2-d]pyrimidine may impart specific biological activities, making it of interest in pharmaceutical research. Additionally, its properties, such as solubility and stability, can be influenced by the substituents and the overall electronic structure of the molecule. As with many heterocycles, this compound may exhibit interesting optical and electronic properties, which can be explored for applications in materials science and organic electronics.

Formula: C₆H₂BrClN₂S

InChI: InChI=1S/C6H2BrClN2S/c7-3-2-11-4-1-9-6(8)10-5(3)4/h1-2H

InChI key: InChIKey=OJKRQQNUFWOJAV-UHFFFAOYSA-N

SMILES: BrC=1C=2C(=CN=C(Cl)N2)SC1

Synonyms:

• 7-Bromo-2-chlorothieno[3,2-d]pyrimidine
• Thieno[3,2-d]pyrimidine, 7-bromo-2-chloro-

Thieno[3,2-d]pyrimidine, 7-bromo-2-chloro-

CAS: 1152475-42-7

Formula: C₆H₂BrClN₂S

Purity: 98%

Color and Shape: Solid

Molecular weight: 249.5155

Ref: IN-DA000GI6

7-Bromo-2-chlorothieno[3,2-d]pyrimidine

CAS: 1152475-42-7

7-Bromo-2-chlorothieno[3,2-d]pyrimidine

Purity: >98%

Molecular weight: 249.52g/mol

Ref: 54-OR902544

7-Bromo-2-chlorothieno[3,2-d]pyrimidine

CAS: 1152475-42-7

7-Bromo-2-chlorothieno[3,2-d]pyrimidine is a high quality, reagent grade compound that is used as an intermediate in the synthesis of other complex compounds. It is also a useful scaffold for the synthesis of speciality chemicals and research chemicals. This compound can be used as a versatile building block for the synthesis of many different compounds.

Formula: C₆H₂BrClN₂S

Purity: Min. 95%

Color and Shape: Off-White To Yellow Solid

Molecular weight: 249.52 g/mol

Ref: 3D-FB156457

7-Bromo-2-chlorothieno[3,2-d]pyrimidine

CAS: 1152475-42-7

Formula: C₆H₂BrClN₂S

Purity: 98%

Color and Shape: Solid

Molecular weight: 249.51

Ref: 10-F077494