CymitQuimica logo

CAS 115248-48-1

:

α-Hydroxy-α-methylbenzeneacetic acid hydrazide

Description:
α-Hydroxy-α-methylbenzeneacetic acid hydrazide, identified by its CAS number 115248-48-1, is a chemical compound that features a hydrazide functional group attached to a substituted aromatic structure. This compound typically exhibits characteristics common to hydrazides, such as the ability to form hydrogen bonds due to the presence of the hydrazine moiety, which can influence its solubility and reactivity. The α-hydroxy and α-methyl substituents contribute to its unique chemical properties, potentially affecting its biological activity and interaction with other molecules. This compound may be of interest in pharmaceutical research, particularly in the development of new therapeutic agents, due to its structural features that can facilitate interactions with biological targets. Additionally, its stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, α-Hydroxy-α-methylbenzeneacetic acid hydrazide represents a class of compounds that may have diverse applications in medicinal chemistry and related fields.
Formula:C9H12N2O2
InChI:InChI=1S/C9H12N2O2/c1-9(13,8(12)11-10)7-5-3-2-4-6-7/h2-6,13H,10H2,1H3,(H,11,12)
InChI key:InChIKey=FFEXJGRBLYVGEB-UHFFFAOYSA-N
SMILES:C(C(NN)=O)(C)(O)C1=CC=CC=C1
Synonyms:
  • 2-Hydroxy-2-phenyl-propionic acid hydrazide
  • Benzeneacetic acid, α-hydroxy-α-methyl-, hydrazide
  • α-Hydroxy-α-methylbenzeneacetic acid hydrazide
  • Atrolactic acid, hydrazide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.