CAS 115249-86-0
:3'-fluoro-2',3'-dideoxy-5-bromouridine
Description:
3'-Fluoro-2',3'-dideoxy-5-bromouridine is a nucleoside analog that exhibits unique structural and chemical characteristics. It is derived from uridine, with modifications that include a fluorine atom at the 3' position and a bromine atom at the 5' position of the pyrimidine ring. These substitutions enhance its potential as an antiviral agent, particularly against RNA viruses, by interfering with viral replication processes. The presence of the dideoxy group indicates that it lacks a hydroxyl group at the 2' and 3' positions, which is crucial for the incorporation of the nucleoside into nucleic acids, thereby terminating chain elongation during RNA synthesis. This compound is often studied for its pharmacological properties and potential therapeutic applications, particularly in the context of viral infections and cancer treatment. Its molecular structure contributes to its ability to mimic natural nucleosides, allowing it to be utilized in various biochemical assays and research applications.
Formula:C9H10BrFN2O4
InChI:InChI=1/C9H10BrFN2O4/c10-4-2-13(9(16)12-8(4)15)7-1-5(11)6(3-14)17-7/h2,5-7,14H,1,3H2,(H,12,15,16)/t5-,6+,7+/m0/s1
Synonyms:- Fddbrurd
- Uridine, 5-bromo-2',3'-dideoxy-3'-fluoro-
- 5-bromo-1-(2,3-dideoxy-3-fluoropentofuranosyl)pyrimidine-2,4(1H,3H)-dione
- 5-Bromo-2',3'-Dideoxy-3'-Fluorouridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
