CAS 1152505-76-4

4-Amino-N-cyclopropyl-α-methyl-1H-pyrazole-1-acetamide

Description:

4-Amino-N-cyclopropyl-α-methyl-1H-pyrazole-1-acetamide is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two adjacent nitrogen atoms. This compound features an amino group and a cyclopropyl group, contributing to its unique reactivity and potential biological activity. The presence of the α-methyl group enhances its steric properties, which can influence its interaction with biological targets. The acetamide functional group suggests potential for hydrogen bonding, which may play a role in its solubility and interaction with other molecules. This compound is of interest in medicinal chemistry, particularly for its potential applications in drug development, as pyrazole derivatives often exhibit a range of pharmacological activities. Its specific characteristics, such as melting point, solubility, and stability, would depend on the molecular environment and conditions under which it is studied. Overall, 4-Amino-N-cyclopropyl-α-methyl-1H-pyrazole-1-acetamide represents a class of compounds that may offer valuable insights into therapeutic applications.

Formula: C₉H₁₄N₄O

InChI: InChI=1S/C9H14N4O/c1-6(9(14)12-8-2-3-8)13-5-7(10)4-11-13/h4-6,8H,2-3,10H2,1H3,(H,12,14)

InChI key: InChIKey=YIUQIKPWBQINKE-UHFFFAOYSA-N

SMILES: C(C(NC1CC1)=O)(C)N2C=C(N)C=N2

Synonyms:

• 1H-Pyrazole-1-acetamide, 4-amino-N-cyclopropyl-α-methyl-
• 4-Amino-N-cyclopropyl-α-methyl-1H-pyrazole-1-acetamide