CymitQuimica logo

CAS 1152536-78-1

:

1-[4-(Chloromethyl)-2-fluorophenyl]-3,5-dimethyl-1H-pyrazole

Description:
1-[4-(Chloromethyl)-2-fluorophenyl]-3,5-dimethyl-1H-pyrazole is a chemical compound characterized by its unique structure, which includes a pyrazole ring substituted with both methyl groups and a chloromethyl-fluorophenyl moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of the chloromethyl group, which can participate in nucleophilic substitution reactions. The fluorine atom in the phenyl ring may influence the compound's electronic properties, potentially enhancing its lipophilicity and biological activity. Additionally, the presence of multiple methyl groups can affect the steric hindrance and solubility of the compound. Such characteristics make it of interest in various fields, including medicinal chemistry, where it may serve as a lead compound for the development of pharmaceuticals or agrochemicals. Its specific applications and behavior would depend on further studies, including its reactivity, biological activity, and interaction with other chemical entities.
Formula:C12H12ClFN2
InChI:InChI=1S/C12H12ClFN2/c1-8-5-9(2)16(15-8)12-4-3-10(7-13)6-11(12)14/h3-6H,7H2,1-2H3
InChI key:InChIKey=WVTDVYYZTPGZKE-UHFFFAOYSA-N
SMILES:CC=1N(N=C(C)C1)C2=C(F)C=C(CCl)C=C2
Synonyms:
  • 1H-Pyrazole, 1-[4-(chloromethyl)-2-fluorophenyl]-3,5-dimethyl-
  • 1-[4-(Chloromethyl)-2-fluorophenyl]-3,5-dimethyl-1H-pyrazole
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.