CymitQuimica logo

CAS 1152549-20-6

:

1-Methyl-α-(2,2,2-trifluoroethyl)-1H-pyrazole-4-methanamine

Description:
1-Methyl-α-(2,2,2-trifluoroethyl)-1H-pyrazole-4-methanamine is a chemical compound characterized by its unique structure, which includes a pyrazole ring substituted with a methyl group and a trifluoroethyl group. This compound is notable for its potential applications in various fields, including pharmaceuticals and agrochemicals, due to the presence of the trifluoroethyl moiety, which can enhance lipophilicity and biological activity. The pyrazole ring contributes to its stability and reactivity, making it a candidate for further chemical modifications. Additionally, the presence of the amine functional group suggests potential for hydrogen bonding and interaction with biological targets. The compound's properties, such as solubility, melting point, and reactivity, would depend on its specific molecular interactions and the environment in which it is used. Overall, 1-Methyl-α-(2,2,2-trifluoroethyl)-1H-pyrazole-4-methanamine represents a class of compounds that may exhibit interesting pharmacological or agricultural properties, warranting further investigation.
Formula:C7H10F3N3
InChI:InChI=1S/C7H10F3N3/c1-13-4-5(3-12-13)6(11)2-7(8,9)10/h3-4,6H,2,11H2,1H3
InChI key:InChIKey=HOPPSXNVBIPBIG-UHFFFAOYSA-N
SMILES:C(CC(F)(F)F)(N)C=1C=NN(C)C1
Synonyms:
  • 1H-Pyrazole-4-methanamine, 1-methyl-α-(2,2,2-trifluoroethyl)-
  • 1-Methyl-α-(2,2,2-trifluoroethyl)-1H-pyrazole-4-methanamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.