CAS 1152556-15-4

4-[Methyl(4-pyridinylcarbonyl)amino]butanoic acid

Description:

4-[Methyl(4-pyridinylcarbonyl)amino]butanoic acid, identified by its CAS number 1152556-15-4, is a chemical compound characterized by its unique structure, which includes a butanoic acid backbone with a methyl group and a pyridine ring substituted at the amino position. This compound features both hydrophilic and lipophilic properties due to the presence of the carboxylic acid group and the aromatic pyridine moiety, which can influence its solubility and reactivity. It is likely to exhibit biological activity, potentially interacting with various biological targets due to the presence of the pyridine ring, which is known for its role in medicinal chemistry. The compound may also participate in hydrogen bonding and other intermolecular interactions, affecting its stability and behavior in different environments. Its synthesis and characterization would typically involve standard organic chemistry techniques, and it may have applications in pharmaceuticals or as a biochemical probe, although specific applications would depend on further research into its properties and interactions.

Formula: C₁₁H₁₄N₂O₃

InChI: InChI=1S/C11H14N2O3/c1-13(8-2-3-10(14)15)11(16)9-4-6-12-7-5-9/h4-7H,2-3,8H2,1H3,(H,14,15)

InChI key: InChIKey=XFDYHPBYZYAHSL-UHFFFAOYSA-N

SMILES: C(N(CCCC(O)=O)C)(=O)C=1C=CN=CC1

Synonyms:

• Butanoic acid, 4-[methyl(4-pyridinylcarbonyl)amino]-
• 4-[Methyl(4-pyridinylcarbonyl)amino]butanoic acid

4-[N-Methyl-1-(pyridin-4-yl)formamido]butanoic acid

CAS: 1152556-15-4

Versatile small molecule scaffold

Formula: C₁₁H₁₄N₂O₃

Purity: Min. 95%

Molecular weight: 222.24 g/mol

Ref: 3D-CWB55615