
CAS 1152566-94-3
:3-Fluoro-4-methyl-N-(1-methylethyl)benzenemethanamine
Description:
3-Fluoro-4-methyl-N-(1-methylethyl)benzenemethanamine, identified by its CAS number 1152566-94-3, is an organic compound characterized by its aromatic structure, which includes a fluorine atom and a methyl group on the benzene ring. The presence of the N-(1-methylethyl) substituent indicates that it has an isopropyl group attached to the amine nitrogen, contributing to its overall hydrophobic character. This compound is likely to exhibit properties typical of amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility in various solvents. The fluorine atom may impart unique electronic properties, potentially affecting the compound's reactivity and interaction with biological systems. As a substituted aniline, it may also exhibit specific pharmacological activities, making it of interest in medicinal chemistry. However, detailed studies would be necessary to fully understand its behavior, stability, and potential applications in various fields, including pharmaceuticals and materials science.
Formula:C11H16FN
InChI:InChI=1S/C11H16FN/c1-8(2)13-7-10-5-4-9(3)11(12)6-10/h4-6,8,13H,7H2,1-3H3
InChI key:InChIKey=IXCNWOMIWXEJQI-UHFFFAOYSA-N
SMILES:C(NC(C)C)C1=CC(F)=C(C)C=C1
Synonyms:- 3-Fluoro-4-methyl-N-(1-methylethyl)benzenemethanamine
- Benzenemethanamine, 3-fluoro-4-methyl-N-(1-methylethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.