CAS 1152568-81-4

4-(1,3-Benzodioxol-5-yl)tetrahydro-2H-pyran-4-methanamine

Description:

4-(1,3-Benzodioxol-5-yl)tetrahydro-2H-pyran-4-methanamine, identified by its CAS number 1152568-81-4, is a chemical compound that features a complex structure incorporating a benzodioxole moiety and a tetrahydropyran ring. This compound is characterized by its potential biological activity, which may include interactions with various receptors or enzymes, making it of interest in medicinal chemistry. The presence of the methanamine functional group suggests that it may exhibit basic properties, allowing for potential protonation under acidic conditions. Its molecular structure indicates that it may possess both hydrophilic and lipophilic characteristics, influencing its solubility and permeability in biological systems. Additionally, the benzodioxole component is often associated with various pharmacological effects, which could contribute to the compound's overall activity. As with many organic compounds, its stability, reactivity, and potential applications would depend on specific environmental conditions and the presence of other chemical entities. Further studies would be necessary to fully elucidate its properties and potential uses in research or therapeutic contexts.

Formula: C₁₃H₁₇NO₃

InChI: InChI=1S/C13H17NO3/c14-8-13(3-5-15-6-4-13)10-1-2-11-12(7-10)17-9-16-11/h1-2,7H,3-6,8-9,14H2

InChI key: InChIKey=CHEZMMVHADBLRW-UHFFFAOYSA-N

SMILES: C(N)C1(CCOCC1)C=2C=C3C(=CC2)OCO3

Synonyms:

• [4-(2H-1,3-Benzodioxol-5-yl)oxan-4-yl]methanamine
• 4-(1,3-Benzodioxol-5-yl)tetrahydro-2H-pyran-4-methanamine
• 2H-Pyran-4-methanamine, 4-(1,3-benzodioxol-5-yl)tetrahydro-
• [4-(1,3-Dioxaindan-5-yl)oxan-4-yl]methanamine

[4-(1,3-Dioxaindan-5-yl)oxan-4-yl]methanamine

CAS: 1152568-81-4

Versatile small molecule scaffold

Formula: C₁₃H₁₇NO₃

Purity: Min. 95%

Molecular weight: 235.28 g/mol

Ref: 3D-CWB56881