
CAS 1152587-00-2
:1-(2-Methylphenyl)cyclobutanamine
Description:
1-(2-Methylphenyl)cyclobutanamine is an organic compound characterized by its cyclobutane ring structure, which is a four-membered carbon ring, and an amine functional group. The presence of a 2-methylphenyl group indicates that a methyl group is attached to the second carbon of a phenyl ring, contributing to the compound's overall hydrophobic character. This compound is likely to exhibit properties typical of amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility in various solvents. The cyclobutane moiety may impart unique steric and electronic properties, potentially affecting its reactivity and interaction with biological systems. As a relatively specialized compound, it may have applications in medicinal chemistry or materials science, although specific uses would depend on further research into its biological activity and chemical behavior. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.
Formula:C11H15N
InChI:InChI=1S/C11H15N/c1-9-5-2-3-6-10(9)11(12)7-4-8-11/h2-3,5-6H,4,7-8,12H2,1H3
InChI key:InChIKey=GJIABTCSJNIWOX-UHFFFAOYSA-N
SMILES:NC1(C2=C(C)C=CC=C2)CCC1
Synonyms:- Cyclobutanamine, 1-(2-methylphenyl)-
- 1-(2-Methylphenyl)cyclobutanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.