CymitQuimica logo

CAS 1152589-09-7

:

4-Chloro-N1-(3-methoxypropyl)-1,2-benzenediamine

Description:
4-Chloro-N1-(3-methoxypropyl)-1,2-benzenediamine is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with a chlorine atom and an amine group. The presence of the methoxypropyl group enhances its solubility and reactivity. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds, which can influence its interactions in various chemical environments. It may be utilized in pharmaceutical applications or as an intermediate in organic synthesis due to its functional groups. The chlorine substituent can also affect its electronic properties, potentially making it a candidate for further chemical modifications. Safety data sheets would indicate handling precautions, as amines can be irritants and may pose health risks. Overall, this compound's unique structure and functional groups contribute to its potential utility in various chemical and industrial applications.
Formula:C10H15ClN2O
InChI:InChI=1S/C10H15ClN2O/c1-14-6-2-5-13-10-4-3-8(11)7-9(10)12/h3-4,7,13H,2,5-6,12H2,1H3
InChI key:InChIKey=RQHYCYWOAOADQZ-UHFFFAOYSA-N
SMILES:N(CCCOC)C1=C(N)C=C(Cl)C=C1
Synonyms:
  • 1,2-Benzenediamine, 4-chloro-N1-(3-methoxypropyl)-
  • 4-Chloro-N1-(3-methoxypropyl)-1,2-benzenediamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.