CAS 1152590-55-0
:1-(1,3-Benzodioxol-5-yl)cyclobutanamine
Description:
1-(1,3-Benzodioxol-5-yl)cyclobutanamine is a chemical compound characterized by its unique bicyclic structure, which includes a cyclobutane ring fused with a benzodioxole moiety. This compound features an amine functional group, which contributes to its potential reactivity and biological activity. The presence of the benzodioxole structure often indicates potential interactions with biological systems, as this moiety is commonly found in various natural products and pharmaceuticals. The compound's molecular structure suggests it may exhibit properties such as moderate lipophilicity, which can influence its solubility and permeability in biological membranes. Additionally, the cyclobutane ring may impart strain, potentially affecting the compound's stability and reactivity. While specific biological activities or applications may not be widely documented, compounds with similar structures have been explored for their pharmacological properties, including neuroactivity and potential therapeutic effects. Overall, 1-(1,3-Benzodioxol-5-yl)cyclobutanamine represents a class of compounds that could be of interest in medicinal chemistry and drug development.
Formula:C11H13NO2
InChI:InChI=1S/C11H13NO2/c12-11(4-1-5-11)8-2-3-9-10(6-8)14-7-13-9/h2-3,6H,1,4-5,7,12H2
InChI key:InChIKey=AFPDQZPKAICGSI-UHFFFAOYSA-N
SMILES:NC1(C=2C=C3C(=CC2)OCO3)CCC1
Synonyms:- Cyclobutanamine, 1-(1,3-benzodioxol-5-yl)-
- 1-(1,3-Benzodioxol-5-yl)cyclobutanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.