
CAS 1152913-89-7
:1-[(3,4-Difluorophenyl)thio]-2-propanone
Description:
1-[(3,4-Difluorophenyl)thio]-2-propanone is an organic compound characterized by the presence of a thioether functional group and a ketone. Its structure features a propanone backbone with a 3,4-difluorophenyl group attached via a sulfur atom, which contributes to its unique chemical properties. This compound is likely to exhibit moderate polarity due to the presence of the electronegative fluorine atoms, which can influence its reactivity and solubility in various solvents. The presence of the thioether group may also impart distinct characteristics, such as potential nucleophilicity and the ability to participate in various chemical reactions, including substitution and addition reactions. Additionally, the fluorine substituents can enhance the compound's stability and alter its electronic properties, making it of interest in medicinal chemistry and material science. Overall, 1-[(3,4-Difluorophenyl)thio]-2-propanone is a versatile compound with potential applications in various fields, including pharmaceuticals and agrochemicals.
Formula:C9H8F2OS
InChI:InChI=1S/C9H8F2OS/c1-6(12)5-13-7-2-3-8(10)9(11)4-7/h2-4H,5H2,1H3
InChI key:InChIKey=BDJDDLMIGAPKDU-UHFFFAOYSA-N
SMILES:S(CC(C)=O)C1=CC(F)=C(F)C=C1
Synonyms:- 2-Propanone, 1-[(3,4-difluorophenyl)thio]-
- 1-[(3,4-Difluorophenyl)thio]-2-propanone
- 1-[(3,4-Difluorophenyl)sulfanyl]propan-2-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.