
CAS 1152950-53-2
:3,5-Dimethyl-1-[(tetrahydro-2-furanyl)methyl]-1H-pyrazol-4-amine
Description:
3,5-Dimethyl-1-[(tetrahydro-2-furanyl)methyl]-1H-pyrazol-4-amine is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. The presence of two methyl groups at the 3 and 5 positions of the pyrazole ring contributes to its hydrophobic character, potentially influencing its solubility and reactivity. The tetrahydro-2-furanyl group attached to the nitrogen at the 1-position introduces a cyclic ether structure, which may enhance the compound's stability and affect its interaction with biological targets. This compound may exhibit various biological activities, making it of interest in medicinal chemistry. Its molecular structure suggests potential for hydrogen bonding and steric interactions, which can influence its pharmacokinetic properties. As with many organic compounds, the specific characteristics such as melting point, boiling point, and solubility would depend on the compound's purity and the conditions under which they are measured. Overall, this compound's unique structural features may provide avenues for further research and application in drug development.
Formula:C10H17N3O
InChI:InChI=1S/C10H17N3O/c1-7-10(11)8(2)13(12-7)6-9-4-3-5-14-9/h9H,3-6,11H2,1-2H3
InChI key:InChIKey=LHUGNFFETPJHAU-UHFFFAOYSA-N
SMILES:C(N1C(C)=C(N)C(C)=N1)C2CCCO2
Synonyms:- 3,5-Dimethyl-1-[(tetrahydro-2-furanyl)methyl]-1H-pyrazol-4-amine
- 1H-Pyrazol-4-amine, 3,5-dimethyl-1-[(tetrahydro-2-furanyl)methyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.