
CAS 1152976-54-9
:3-(1H-Pyrazol-1-ylmethyl)benzenesulfonamide
Description:
3-(1H-Pyrazol-1-ylmethyl)benzenesulfonamide is a chemical compound characterized by the presence of a sulfonamide group attached to a benzene ring, which is further substituted with a pyrazole moiety. This compound typically exhibits properties associated with both sulfonamides and pyrazoles, including potential biological activity. Sulfonamides are known for their antibacterial properties, while pyrazoles can exhibit a range of pharmacological effects. The structure suggests that it may participate in hydrogen bonding due to the sulfonamide functional group, which can enhance its solubility in polar solvents. Additionally, the presence of the pyrazole ring may contribute to its reactivity and interaction with biological targets. The compound's molecular weight, solubility, and stability can vary based on environmental conditions and the presence of other functional groups. Overall, 3-(1H-Pyrazol-1-ylmethyl)benzenesulfonamide is of interest in medicinal chemistry and may serve as a lead compound for further drug development.
Formula:C10H11N3O2S
InChI:InChI=1S/C10H11N3O2S/c11-16(14,15)10-4-1-3-9(7-10)8-13-6-2-5-12-13/h1-7H,8H2,(H2,11,14,15)
InChI key:InChIKey=ULNYQBDIIHNTOO-UHFFFAOYSA-N
SMILES:C(C1=CC(S(N)(=O)=O)=CC=C1)N2C=CC=N2
Synonyms:- Benzenesulfonamide, 3-(1H-pyrazol-1-ylmethyl)-
- 3-[(1H-Pyrazol-1-yl)methyl]benzene-1-sulfonamide
- 3-(1H-Pyrazol-1-ylmethyl)benzenesulfonamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.