CAS 1152979-18-4

1H-Pyrazole-4-carboxylic acid, 1-(4-bromophenyl)-5-chloro-3-(trifluoromethyl)-

Description:

1H-Pyrazole-4-carboxylic acid, 1-(4-bromophenyl)-5-chloro-3-(trifluoromethyl)- is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. This compound features a carboxylic acid functional group at the 4-position, contributing to its acidity and potential reactivity. The presence of a 4-bromophenyl group enhances its aromatic character and may influence its biological activity. Additionally, the 5-chloro and 3-(trifluoromethyl) substituents introduce significant electronegative elements, which can affect the compound's electronic properties and lipophilicity. This structure suggests potential applications in pharmaceuticals or agrochemicals, as modifications to pyrazole derivatives are often explored for their biological activities. The compound's unique combination of functional groups may also impart specific solubility characteristics and reactivity patterns, making it of interest in synthetic chemistry and material science. Overall, the compound's distinct features position it as a valuable entity for further research and development in various chemical applications.

Formula: C₁₁H₅BrClF₃N₂O₂

InChI: InChI=1S/C11H5BrClF3N2O2/c12-5-1-3-6(4-2-5)18-9(13)7(10(19)20)8(17-18)11(14,15)16/h1-4H,(H,19,20)

InChI key: InChIKey=YHCQSKLBUCOCPL-UHFFFAOYSA-N

SMILES: ClC=1N(N=C(C(F)(F)F)C1C(O)=O)C2=CC=C(Br)C=C2

Synonyms:

• 1H-Pyrazole-4-carboxylic acid, 1-(4-bromophenyl)-5-chloro-3-(trifluoromethyl)-
• 1-(4-Bromophenyl)-5-chloro-3-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid

1-(4-bromophenyl)-5-chloro-3-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid

CAS: 1152979-18-4

Formula: C₁₁H₅BrClF₃N₂O₂

Purity: 95%

Molecular weight: 369.5218

Ref: IN-DA01DTN1