CymitQuimica logo

CAS 1153-07-7

:

Spiro[11H-dibenz[b,e]azepine-11,2′-[1,3]dioxolan]-6(5H)-one

Description:
Spiro[11H-dibenz[b,e]azepine-11,2′-[1,3]dioxolan]-6(5H)-one, with the CAS number 1153-07-7, is a heterocyclic compound characterized by its unique spiro structure, which consists of a dibenzazepine core fused with a dioxolane ring. This compound typically exhibits a complex arrangement of carbon, nitrogen, and oxygen atoms, contributing to its potential biological activity. The presence of the dibenzazepine moiety suggests possible interactions with various biological targets, making it of interest in medicinal chemistry. The dioxolane ring adds to its stability and may influence its solubility and reactivity. Generally, compounds of this nature can exhibit a range of properties, including fluorescence and the ability to participate in various chemical reactions, such as nucleophilic substitutions or cycloadditions. Its specific applications and behavior would depend on the functional groups present and the overall molecular conformation. As with many heterocycles, it may also show potential as a scaffold for drug development, particularly in the fields of neuropharmacology and anti-cancer research.
Formula:C16H13NO3
InChI:InChI=1S/C16H13NO3/c18-15-11-5-1-2-6-12(11)16(19-9-10-20-16)13-7-3-4-8-14(13)17-15/h1-8H,9-10H2,(H,17,18)
InChI key:InChIKey=DNWGLYLCBVNJPU-UHFFFAOYSA-N
SMILES:O=C1C=2C(C3(C=4C(N1)=CC=CC4)OCCO3)=CC=CC2
Synonyms:
  • Spiro[11H-dibenz[b,e]azepine-11,2′-[1,3]dioxolan]-6(5H)-one
  • 6,11(5H)-Morphanthridinedione, cyclic 11-(ethylene acetal)
  • Spiro[1,3-dioxolane-2,11′-morphanthridin]-6′(5′H)-one
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.