
CAS 1153-67-9
:3,5-Diethyl 4-ethyl-2,6-dimethyl-3,5-pyridinedicarboxylate
Description:
3,5-Diethyl 4-ethyl-2,6-dimethyl-3,5-pyridinedicarboxylate, with CAS number 1153-67-9, is an organic compound belonging to the class of pyridine derivatives. This substance features a pyridine ring substituted with multiple ethyl and methyl groups, as well as two carboxylate ester functionalities. The presence of these substituents contributes to its unique chemical properties, including its potential solubility in organic solvents and its reactivity in various chemical reactions. The compound may exhibit moderate to high lipophilicity due to the alkyl groups, which can influence its biological activity and interaction with other molecules. Additionally, the presence of the carboxylate groups suggests potential for hydrogen bonding and participation in various chemical transformations. While specific applications may vary, compounds of this type are often explored in fields such as pharmaceuticals, agrochemicals, and materials science due to their diverse functional properties. Safety data and handling precautions should be consulted, as with any chemical substance, to ensure proper usage and risk management.
Formula:C15H21NO4
InChI:InChI=1S/C15H21NO4/c1-6-11-12(14(17)19-7-2)9(4)16-10(5)13(11)15(18)20-8-3/h6-8H2,1-5H3
InChI key:InChIKey=MZUUZRYSBHOJQX-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C=1C(CC)=C(C(OCC)=O)C(C)=NC1C
Synonyms:- 3,5-Dicarboethoxy-2,6-dimethyl-4-ethylpyridine
- 3,5-Pyridinedicarboxylic acid, 4-ethyl-2,6-dimethyl-, diethyl ester
- 3,5-Diethyl 4-ethyl-2,6-dimethyl-3,5-pyridinedicarboxylate
- 3,5-Diethoxycarbonyl-2,6-dimethyl-4-ethylpyridine
- 3,5-Pyridinedicarboxylic acid, 4-ethyl-2,6-dimethyl-, 3,5-diethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3,5-Pyridinedicarboxylic acid, 4-ethyl-2,6-dimethyl-, 3,5-diethyl ester
CAS:Formula:C15H21NO4Molecular weight:279.3315
