CAS 115311-26-7

2-[4-(1-Methylethyl)phenyl]-4-thiazolecarboxylic acid

Description:

2-[4-(1-Methylethyl)phenyl]-4-thiazolecarboxylic acid, with the CAS number 115311-26-7, is a chemical compound characterized by its thiazole and aromatic structures. This compound features a thiazole ring, which is a five-membered heterocyclic ring containing sulfur and nitrogen, contributing to its unique chemical properties. The presence of the isopropyl group (1-methylethyl) on the phenyl ring enhances its hydrophobic characteristics, potentially influencing its solubility and reactivity. The carboxylic acid functional group (-COOH) provides acidic properties, allowing for potential interactions with bases and the formation of salts. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its structural features suggest potential applications in medicinal chemistry, particularly in the development of compounds with specific biological targets. Overall, the combination of its thiazole and aromatic components, along with the carboxylic acid functionality, contributes to its chemical behavior and potential utility in various chemical and biological contexts.

Formula: C₁₃H₁₃NO₂S

InChI: InChI=1S/C13H13NO2S/c1-8(2)9-3-5-10(6-4-9)12-14-11(7-17-12)13(15)16/h3-8H,1-2H3,(H,15,16)

InChI key: InChIKey=CASMWKSPVZDRCY-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1N=C(SC1)C2=CC=C(C(C)C)C=C2

Synonyms:

• 2-[4-(Propan-2-yl)phenyl]-1,3-thiazole-4-carboxylic acid
• 2-[4-(1-Methylethyl)phenyl]-4-thiazolecarboxylic acid
• 2-(4-Isopropylphenyl)-1,3-thiazole-4-carboxylic acid
• 4-Thiazolecarboxylic acid, 2-[4-(1-methylethyl)phenyl]-