CAS 115311-42-7

4-Thiazolecarboxylic acid, 2-(6-methyl-2-pyridinyl)-

Description:

4-Thiazolecarboxylic acid, 2-(6-methyl-2-pyridinyl)-, identified by CAS number 115311-42-7, is a heterocyclic organic compound featuring both thiazole and pyridine moieties. This compound typically exhibits characteristics common to carboxylic acids, such as the presence of a carboxyl functional group (-COOH), which contributes to its acidity and potential reactivity in various chemical reactions. The thiazole ring, a five-membered aromatic ring containing sulfur and nitrogen, imparts unique electronic properties, making it useful in medicinal chemistry and as a building block in the synthesis of pharmaceuticals. The presence of the 6-methyl-2-pyridinyl group enhances its lipophilicity and may influence its biological activity. This compound may exhibit antimicrobial, antifungal, or anti-inflammatory properties, making it of interest in drug development. Its solubility, stability, and reactivity can vary based on environmental conditions and the presence of other functional groups. Overall, 4-Thiazolecarboxylic acid, 2-(6-methyl-2-pyridinyl)- is a versatile compound with potential applications in various fields, including pharmaceuticals and agrochemicals.

Formula: C₁₀H₈N₂O₂S

InChI: InChI=1S/C10H8N2O2S/c1-6-3-2-4-7(11-6)9-12-8(5-15-9)10(13)14/h2-5H,1H3,(H,13,14)

InChI key: InChIKey=XCLXGIWVYJXHOD-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1N=C(SC1)C=2N=C(C)C=CC2

Synonyms:

• 2-(6-Methylpyridin-2-yl)thiazole-4-carboxylic acid
• 2-(6-Methylpyridin-2-yl)-1,3-thiazole-4-carboxylic acid
• 4-Thiazolecarboxylic acid, 2-(6-methyl-2-pyridinyl)-