CAS 1153165-79-7
:4,8-Dichloro-6-methyl-2-phenylquinoline
Description:
4,8-Dichloro-6-methyl-2-phenylquinoline is a synthetic organic compound characterized by its quinoline backbone, which is a bicyclic structure containing a benzene ring fused to a pyridine ring. This compound features two chlorine atoms at the 4 and 8 positions, a methyl group at the 6 position, and a phenyl group at the 2 position, contributing to its unique chemical properties. The presence of chlorine atoms typically enhances the compound's lipophilicity and may influence its reactivity and biological activity. The methyl and phenyl substituents can also affect the compound's solubility and stability. As a member of the quinoline family, it may exhibit various pharmacological activities, making it of interest in medicinal chemistry. Its CAS number, 1153165-79-7, allows for precise identification in chemical databases. Overall, the structural features of 4,8-Dichloro-6-methyl-2-phenylquinoline suggest potential applications in pharmaceuticals, though specific biological activities would require further investigation.
Formula:C16H11Cl2N
InChI:InChI=1S/C16H11Cl2N/c1-10-7-12-13(17)9-15(11-5-3-2-4-6-11)19-16(12)14(18)8-10/h2-9H,1H3
InChI key:InChIKey=IQGWMLKBQLEFQG-UHFFFAOYSA-N
SMILES:ClC=1C2=C(C(Cl)=CC(=N2)C3=CC=CC=C3)C=C(C)C1
Synonyms:- 4,8-Dichloro-6-methyl-2-phenylquinoline
- Quinoline, 4,8-dichloro-6-methyl-2-phenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
