CAS 115321-32-9
:(8R)-8-(furan-3-yl)-7-methyl-4,8-dihydro-3H-furo[3',4':3,4]cyclohepta[1,2-f][2]benzofuran-3,10(1H)-dione
Description:
The chemical substance with the name "(8R)-8-(furan-3-yl)-7-methyl-4,8-dihydro-3H-furo[3',4':3,4]cyclohepta[1,2-f][2]benzofuran-3,10(1H)-dione" and CAS number "115321-32-9" is characterized by its complex polycyclic structure, which includes multiple fused rings and functional groups. This compound features a furan moiety, contributing to its aromatic properties and potential reactivity. The presence of a diketone functional group (3,10-dione) suggests that it may participate in various chemical reactions, such as nucleophilic additions or condensation reactions. The stereochemistry indicated by the (8R) designation implies specific spatial arrangements of atoms, which can influence the compound's biological activity and interactions. Additionally, the methyl group at position 7 may affect the compound's solubility and stability. Overall, this substance is of interest in fields such as medicinal chemistry and organic synthesis, where its unique structure may confer specific pharmacological properties or serve as a precursor for further chemical modifications.
Formula:C20H14O5
InChI:InChI=1/C20H14O5/c1-10-12-3-2-4-13-16(9-24-19(13)21)14(12)7-15-17(10)18(25-20(15)22)11-5-6-23-8-11/h2-3,5-8,18H,4,9H2,1H3/t18-/m0/s1
SMILES:Cc1c2C=CCC3=C(COC3=O)c2cc2c1[C@H](c1ccoc1)OC2=O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
3H-Furo[3',4':3,4]cyclohept[1,2-f]isobenzofuran-3,10(1H)-dione, 8-(3-furanyl)-4,8-dihydro-7-methyl-, (8R)-
CAS:Formula:C20H14O5Purity:95.0%Molecular weight:334.3222Isosalvipuberulin
CAS:Isosalvipuberulin is a secondary metabolite, which is a complex organic compound primarily synthesized by plants. It is derived from specific plant species and is often associated with the chemical defense mechanisms of these organisms. The compound acts at the biochemical level by interacting with various molecular targets within biological systems. This interaction can potentially alter physiological responses, thereby rendering the compound of interest to the scientific community, particularly in pharmacological and therapeutic research.Formula:C20H14O5Purity:Min. 95%Molecular weight:334.3 g/mol


