CymitQuimica logo

CAS 1153230-10-4

:

2-(2-Fluorophenyl)-1-(3-hydroxy-1-piperidinyl)ethanone

Description:
2-(2-Fluorophenyl)-1-(3-hydroxy-1-piperidinyl)ethanone, identified by its CAS number 1153230-10-4, is a chemical compound characterized by its unique structural features. It contains a fluorophenyl group, which contributes to its potential biological activity, and a piperidine ring that includes a hydroxyl group, enhancing its solubility and reactivity. This compound is likely to exhibit properties typical of both aromatic and aliphatic systems, including potential interactions with biological targets due to its functional groups. The presence of the fluorine atom may influence its lipophilicity and metabolic stability, making it of interest in medicinal chemistry. Additionally, the hydroxyl group can participate in hydrogen bonding, which may affect its pharmacokinetic properties. Overall, this compound's structure suggests it could be investigated for various applications, particularly in the pharmaceutical industry, where modifications to such scaffolds can lead to the development of novel therapeutic agents. However, specific biological activities and safety profiles would require further empirical studies.
Formula:C13H16FNO2
InChI:InChI=1S/C13H16FNO2/c14-12-6-2-1-4-10(12)8-13(17)15-7-3-5-11(16)9-15/h1-2,4,6,11,16H,3,5,7-9H2
InChI key:InChIKey=WLFLWVHPIPREKU-UHFFFAOYSA-N
SMILES:C(CC1=C(F)C=CC=C1)(=O)N2CC(O)CCC2
Synonyms:
  • 2-(2-Fluorophenyl)-1-(3-hydroxy-1-piperidinyl)ethanone
  • Ethanone, 2-(2-fluorophenyl)-1-(3-hydroxy-1-piperidinyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.