CAS 115339-34-9

N-(4-amino-6-chloro-1,3,5-triazin-2-yl)acetamide

Description:

N-(4-amino-6-chloro-1,3,5-triazin-2-yl)acetamide, with the CAS number 115339-34-9, is a chemical compound characterized by its triazine ring structure, which is a six-membered heterocyclic compound containing three nitrogen atoms. This substance features an amino group and a chloro substituent on the triazine ring, contributing to its reactivity and potential applications in various fields, including agrochemicals and pharmaceuticals. The acetamide functional group enhances its solubility in polar solvents and may influence its biological activity. Typically, compounds of this nature exhibit properties such as moderate stability under standard conditions, potential for hydrogen bonding due to the amide group, and the ability to participate in nucleophilic substitution reactions due to the presence of the chlorine atom. Its specific applications may vary, but it is often investigated for its role in herbicides or as a building block in the synthesis of more complex molecules. Safety data and handling precautions should be considered, as with any chemical substance.

Formula: C₅H₆ClN₅O

InChI: InChI=1/C5H6ClN5O/c1-2(12)8-5-10-3(6)9-4(7)11-5/h1H3,(H3,7,8,9,10,11,12)

SMILES: CC(=Nc1nc(Cl)nc(=N)[nH]1)O

Synonyms:

• acetamide, N-(4-amino-6-chloro-1,3,5-triazin-2-yl)-

2-Chloro-4-acetamido-6-amino-s-triazine

Controlled Product

CAS: 115339-34-9

Formula: C₅H₆ClN₅O

Color and Shape: Neat

Molecular weight: 187.587

Ref: TR-C363410