
CAS 115365-42-9
:2-(7-Hexadecen-1-yl)-11-eicosen-1-yl hexadecanoate
Description:
2-(7-Hexadecen-1-yl)-11-eicosen-1-yl hexadecanoate, with the CAS number 115365-42-9, is a chemical compound that belongs to the class of fatty acid esters. This substance features a long hydrocarbon chain, which contributes to its hydrophobic characteristics, making it insoluble in water but soluble in organic solvents. The presence of multiple double bonds in its structure indicates that it is an unsaturated fatty acid ester, which can influence its physical properties, such as melting point and viscosity. This compound may exhibit biological activity, potentially serving as a surfactant or emulsifier due to its amphiphilic nature. Its structural complexity suggests potential applications in various fields, including cosmetics, food, and pharmaceuticals, where it may function as an ingredient or additive. Additionally, the specific arrangement of carbon chains and functional groups can affect its reactivity and stability under different conditions, making it a subject of interest in both industrial and research settings.
Formula:C52H100O2
InChI:InChI=1S/C52H100O2/c1-4-7-10-13-16-19-22-25-27-28-31-33-36-39-42-45-48-51(47-44-41-38-35-32-30-26-23-20-17-14-11-8-5-2)50-54-52(53)49-46-43-40-37-34-29-24-21-18-15-12-9-6-3/h25-27,30,51H,4-24,28-29,31-50H2,1-3H3
InChI key:InChIKey=ZEZBFWADYPBYLV-UHFFFAOYSA-N
SMILES:C(COC(CCCCCCCCCCCCCCC)=O)(CCCCCCCCC=CCCCCCCCC)CCCCCCC=CCCCCCCCC
Synonyms:- Hexadecanoic acid, 2-(7-hexadecen-1-yl)-11-eicosen-1-yl ester
- Hexadecanoic acid, 2-(7-hexadecenyl)-11-eicosenyl ester
- 2-(7-Hexadecen-1-yl)-11-eicosen-1-yl hexadecanoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Hexadecanoic acid, 2-(7-hexadecen-1-yl)-11-eicosen-1-yl ester
CAS:Formula:C52H100O2Molecular weight:757.3492
