CymitQuimica logo

CAS 115365-43-0

:

2-(7-Hexadecen-1-yl)-11-eicosen-1-yl octadecanoate

Description:
2-(7-Hexadecen-1-yl)-11-eicosen-1-yl octadecanoate, with the CAS number 115365-43-0, is a complex ester derived from fatty acids and long-chain alcohols. This compound features a long hydrocarbon chain structure, which contributes to its hydrophobic characteristics and potential applications in various fields, including cosmetics and pharmaceuticals. The presence of multiple double bonds in its alkyl chains indicates that it may exhibit unsaturation, which can influence its physical properties, such as melting point and solubility. Additionally, the ester functional group suggests that it may have a relatively low volatility and could serve as a surfactant or emulsifier. Its molecular structure implies potential bioactivity, making it of interest in research related to lipid metabolism and cellular functions. Overall, this compound's unique characteristics stem from its long-chain fatty acid and alcohol components, which can affect its behavior in biological systems and industrial applications.
Formula:C54H104O2
InChI:InChI=1S/C54H104O2/c1-4-7-10-13-16-19-22-25-28-30-32-35-38-41-44-47-50-53(49-46-43-40-37-34-31-27-24-21-18-15-12-9-6-3)52-56-54(55)51-48-45-42-39-36-33-29-26-23-20-17-14-11-8-5-2/h25,27-28,31,53H,4-24,26,29-30,32-52H2,1-3H3
InChI key:InChIKey=UMXQQDQSXLCIOV-UHFFFAOYSA-N
SMILES:C(COC(CCCCCCCCCCCCCCCCC)=O)(CCCCCCCCC=CCCCCCCCC)CCCCCCC=CCCCCCCCC
Synonyms:
  • Octadecanoic acid, 2-(7-hexadecenyl)-11-eicosenyl ester
  • Octadecanoic acid, 2-(7-hexadecen-1-yl)-11-eicosen-1-yl ester
  • 2-(7-Hexadecen-1-yl)-11-eicosen-1-yl octadecanoate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.