CAS 115388-32-4
:5,5′-Diethoxy-3,3′,4,4′-tetrahydro-8,8′-dimethoxy-1,1′-binaphthalene
Description:
5,5′-Diethoxy-3,3′,4,4′-tetrahydro-8,8′-dimethoxy-1,1′-binaphthalene, with CAS number 115388-32-4, is an organic compound characterized by its complex structure, which includes two naphthalene units connected by a tetrahydro bridge. This compound features multiple ethoxy and methoxy substituents, contributing to its unique chemical properties. It is typically a solid at room temperature and may exhibit a range of solubility in organic solvents, depending on the solvent's polarity. The presence of methoxy and ethoxy groups can influence its reactivity, making it potentially useful in organic synthesis and materials science. Additionally, the stereochemistry of the binaphthalene framework may impart interesting optical properties, which could be relevant in applications such as chiral catalysts or optoelectronic devices. Overall, this compound's structural features suggest potential utility in various chemical applications, although specific reactivity and stability would depend on the conditions under which it is used.
Formula:C26H30O4
InChI:InChI=1S/C26H30O4/c1-5-29-21-13-15-23(27-3)25-17(9-7-11-19(21)25)18-10-8-12-20-22(30-6-2)14-16-24(28-4)26(18)20/h9-10,13-16H,5-8,11-12H2,1-4H3
InChI key:InChIKey=QEADYXIBWWENKY-UHFFFAOYSA-N
SMILES:O(C)C1=C2C(=CCCC2=C(OCC)C=C1)C=3C=4C(=C(OCC)C=CC4OC)CCC3
Synonyms:- 5,5′-Diethoxy-3,3′,4,4′-tetrahydro-8,8′-dimethoxy-1,1′-binaphthalene
- 1,1′-Binaphthalene, 5,5′-diethoxy-3,3′,4,4′-tetrahydro-8,8′-dimethoxy-
- 1,1′-Binaphthyl, 5,5′-diethoxy-3,3′,4,4′-tetrahydro-8,8′-dimethoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-(4-(4-(2-Methoxyphenyl)piperazin-1-yl)butyl)isoindoline-1,3-dione hydrobromide
CAS:Formula:C23H28BrN3O3Molecular weight:474.3907
