CAS 115388-93-7
:H-PRO-AMC HBR
Description:
H-PRO-AMC HBr, with the CAS number 115388-93-7, is a chemical compound that serves as a peptide derivative, specifically a protected form of proline. It is commonly utilized in peptide synthesis and research due to its role as a building block in the formation of peptides and proteins. The "H" in its name indicates that it is in the form of a hydrochloride salt, which enhances its solubility in aqueous solutions, making it easier to handle in laboratory settings. The presence of the bromide ion (Br) suggests that it is a hydrobromide salt, which can influence its stability and reactivity. This compound is typically characterized by its ability to participate in various coupling reactions, facilitating the formation of peptide bonds. Additionally, it may exhibit specific biological activities depending on the context of its use in research or therapeutic applications. As with many chemical substances, proper handling and safety precautions are essential due to potential hazards associated with its use.
Formula:C15H17N2O3
InChI:InChI=1/C15H16N2O3/c1-9-7-14(18)20-13-8-10(4-5-11(9)13)17-15(19)12-3-2-6-16-12/h4-5,7-8,12,16H,2-3,6H2,1H3,(H,17,19)/p+1/t12-/m0/s1
Synonyms:- L-Proline-7-Amido-4-Methylcoumarin Hbr
- L-Proline 7-Amido-4-Methyl-Coumarin Hydrobromide
- L-Proline 7-Amido-4-Methylcoumarin Hydrobromide Salt
- L-Proline-Amc Hbr
- Proline-Amc Hbr
- L-Proline7-amido-4-methycouraminhydrobromidesalt
- (2S)-N-(4-Methyl-2-Oxo-Chromen-7-Yl)-2,3,4,5-Tetrahydropyrrole-2-Carboxamide
- N-(4-methyl-2-oxo-2H-chromen-7-yl)-L-prolinamide hydrobromide
- (2S)-2-[(4-methyl-2-oxo-2H-chromen-7-yl)carbamoyl]pyrrolidinium
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
L-Proline 7-amido-4-methylcoumarin hydrobromide salt
CAS:L-Proline 7-amido-4-methylcoumarin hydrobromide saltFormula:C15H16N2O3·BrHPurity:By hplc: >98% (Typical Value in Batch COA)Color and Shape: white powderMolecular weight:353.21g/molL-Proline 7-amido-4-methylcoumarin hydrobromide salt
CAS:<p>L-Proline 7-amido-4-methylcoumarin hydrobromide salt is a fluorogenic peptide substrate for proline-specific peptidase. This AMC peptide substrate is normally used to rapidly profile the N-terminal specificity of proteases.</p>Formula:C15H17BrN2O3Purity:Min. 95%Color and Shape:PowderMolecular weight:353.22 g/molL-Proline 7-amido-4-methylcoumarin hydrobromide
CAS:<p>L-Proline 7-amido-4-methylcoumarin hydrobromide is a fluorogenic substrate that is used to measure esterase and peptidase activity in a variety of animal and microbial sources. This compound has been shown to have a lipase activity. L-Proline 7-amido-4-methylcoumarin hydrobromide is also used as an enzyme preparation and as an enzyme source.</p>Formula:C15H17BrN2O3Molecular weight:353.22 g/molRef: 3D-P-7280
1gTo inquire5gTo inquire10gTo inquire500mgTo inquire2500mgTo inquire-Unit-ggTo inquireL-Proline-7-Amido-4-Methylcoumarin Hydrobromide Salt extrapure, 98%
CAS:Formula:C15H17BrN2O3Molecular weight:353.2L-Proline 7-Amido-4-methylcoumarin Hydrobromide
CAS:Controlled ProductFormula:C15H16N2O3•HBrColor and Shape:NeatMolecular weight:353.21





