CymitQuimica logo

CAS 115388-96-0

:

D-phe-L-pipecolyl-arg P-nitroanilide*dihydrochlor

Description:
D-phe-L-pipecolyl-arg P-nitroanilide dihydrochloride, identified by the CAS number 115388-96-0, is a synthetic compound primarily used in biochemical research, particularly in the study of proteases and enzyme activity. This substance is characterized by its specific amino acid sequence, which includes D-phenylalanine (D-phe), L-pipecolic acid, and arginine (arg), linked to a p-nitroanilide moiety. The p-nitroanilide group serves as a chromogenic substrate, allowing for the detection of enzymatic activity through colorimetric changes. The dihydrochloride form indicates the presence of two hydrochloride ions, which can enhance the solubility of the compound in aqueous solutions. Its structural features contribute to its role as a substrate in various biochemical assays, making it valuable in the study of enzyme kinetics and inhibition. As with many synthetic peptides, it is essential to handle this compound with care, following appropriate safety protocols in laboratory settings.
Formula:C27H36N8O5·3C2H4O2
InChI:InChI=1S/C27H36N8O5/c28-21(17-18-7-2-1-3-8-18)26(38)34-16-5-4-10-23(34)25(37)33-22(9-6-15-31-27(29)30)24(36)32-19-11-13-20(14-12-19)35(39)40/h1-3,7-8,11-14,21-23H,4-6,9-10,15-17,28H2,(H,32,36)(H,33,37)(H4,29,30,31)/t21-,22+,23?/m1/s1
InChI key:YDMBNDUHUNWWRP-AXWGZAFASA-N
SMILES:C1CCN(C(C1)C(=O)N[C@@H](CCCN=C(N)N)C(=O)NC2=CC=C(C=C2)[N+](=O)[O-])C(=O)[C@@H](CC3=CC=CC=C3)N
Found 6 products.