CAS 115388-97-1
:β-L-lyxo-Hexopyranoside, methyl 3-amino-2,3,6-trideoxy-, hydrochloride (1:1)
Description:
β-L-lyxo-Hexopyranoside, methyl 3-amino-2,3,6-trideoxy-, hydrochloride (1:1), with the CAS number 115388-97-1, is a chemical compound characterized by its structural features as a sugar derivative. It contains a pyranose ring, which is a six-membered cyclic structure typical of many carbohydrates. The presence of a methyl group and an amino group indicates that it is a modified sugar, specifically a trideoxy sugar, meaning it lacks three hydroxyl groups typically found in standard hexoses. The hydrochloride form suggests that the compound is a salt, which can enhance its solubility in water and stability. This compound may exhibit biological activity due to its amino group, which can participate in various biochemical interactions. Its specific stereochemistry, denoted by the β configuration, plays a crucial role in determining its reactivity and interaction with biological molecules. Overall, this compound is of interest in biochemical research and potential pharmaceutical applications, particularly in the study of glycosylation and carbohydrate-related processes.
Formula:C7H15NO3·ClH
InChI:InChI=1S/C7H15NO3.ClH/c1-4-7(9)5(8)3-6(10-2)11-4;/h4-7,9H,3,8H2,1-2H3;1H/t4-,5-,6-,7+;/m0./s1
InChI key:InChIKey=JVYGBUAXDCLPMP-VPHMISFWSA-N
SMILES:O(C)[C@@H]1C[C@H](N)[C@H](O)[C@H](C)O1.Cl
Synonyms:- Methyl 3-Amino-2,3,6-Trideoxyhexopyranoside Hydrochloride
- β-<span class="text-smallcaps">L</span>-lyxo-Hexopyranoside, methyl 3-amino-2,3,6-trideoxy-, hydrochloride
- β-<span class="text-smallcaps">L</span>-lyxo-Hexopyranoside, methyl 3-amino-2,3,6-trideoxy-, hydrochloride (1:1)
- β-L-lyxo-Hexopyranoside, methyl 3-amino-2,3,6-trideoxy-, hydrochloride (1:1)
- β-L-lyxo-Hexopyranoside, methyl 3-amino-2,3,6-trideoxy-, hydrochloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Methyl b-L-daunosaminide HCl
CAS:Methyl b-L-daunosaminide HCl is a glycoconjugate that has been custom synthesized by our team. It is a complex carbohydrate that has been modified with glycosylation and methylation groups. Methyl b-L-daunosaminide HCl is an oligosaccharide that contains multiple saccharides linked together in a specific order. It is also fluorinated at the C4 position, which makes it more stable in water. Methyl b-L-daunosaminide HCl has high purity, making it suitable for use in the modification of other compounds or as a research tool for studying glycosylations.
Formula:C7H15NO3·HClPurity:Min. 95%Molecular weight:197.66 g/mol

