CymitQuimica logo

CAS 115397-30-3

:

N-Methoxy-3-methyl-3H-imidazo[4,5-f]quinolin-2-amine

Description:
N-Methoxy-3-methyl-3H-imidazo[4,5-f]quinolin-2-amine is a chemical compound characterized by its complex heterocyclic structure, which includes an imidazole and quinoline moiety. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in medicinal chemistry. The presence of the methoxy group and the amine functionality suggests that it may participate in hydrogen bonding and other interactions, influencing its reactivity and biological activity. Its molecular structure may allow for interactions with various biological targets, which could be relevant in drug development. Additionally, compounds of this type may exhibit fluorescence properties, making them useful in biochemical assays. As with many heterocycles, the stability and reactivity can vary based on environmental conditions such as pH and temperature. Overall, N-Methoxy-3-methyl-3H-imidazo[4,5-f]quinolin-2-amine represents a class of compounds that may have significant implications in pharmaceutical research and development.
Formula:C12H12N4O
InChI:InChI=1S/C12H12N4O/c1-16-10-6-5-9-8(4-3-7-13-9)11(10)14-12(16)15-17-2/h3-7H,1-2H3,(H,14,15)
InChI key:InChIKey=KYFVXKWADPVVOM-UHFFFAOYSA-N
SMILES:CN1C2=C(C=3C(C=C2)=NC=CC3)NC1=NOC
Synonyms:
  • 3H-Imidazo[4,5-f]quinolin-2-amine, N-methoxy-3-methyl-
  • N-Methoxy-3-methyl-3H-imidazo[4,5-f]quinolin-2-amine
  • 2H-Imidazo[4,5-f]quinolin-2-one, 1,3-dihydro-3-methyl-, O-methyloxime
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.