CAS 115398-67-9

4-amino-5-[(1,3-benzodioxol-5-yloxy)methyl]-2,4-dihydro-3H-1,2,4-triazole-3-thione

Description:

4-amino-5-[(1,3-benzodioxol-5-yloxy)methyl]-2,4-dihydro-3H-1,2,4-triazole-3-thione is a chemical compound characterized by its triazole core, which is a five-membered heterocyclic ring containing three nitrogen atoms. This compound features an amino group and a thione functional group, which contributes to its reactivity and potential biological activity. The presence of the benzodioxole moiety indicates that it may exhibit interesting pharmacological properties, as benzodioxoles are often associated with various biological activities. The compound's structure suggests it may be soluble in polar solvents due to the presence of functional groups that can engage in hydrogen bonding. Its molecular weight, stability, and specific reactivity would depend on the arrangement of its substituents and the overall electronic environment. Given its complex structure, it may be of interest in medicinal chemistry, particularly in the development of new therapeutic agents. However, specific properties such as melting point, boiling point, and solubility would require empirical data for precise characterization.

Formula: C₁₀H₁₀N₄O₃S

InChI: InChI=1/C10H10N4O3S/c11-14-9(12-13-10(14)18)4-15-6-1-2-7-8(3-6)17-5-16-7/h1-3H,4-5,11H2,(H,13,18)