CAS 1154-08-1
:(5Z)-5-(3-aminopropylidene)-10,11-dihydro-5H-dibenzo[a,d][7]annulen-10-ol
Description:
The chemical substance known as (5Z)-5-(3-aminopropylidene)-10,11-dihydro-5H-dibenzo[a,d][7]annulen-10-ol, with the CAS number 1154-08-1, is a complex organic compound characterized by its unique structural features, including a dibenzo[a,d]annulene framework. This compound contains a hydroxyl group (-OH) and an amino group (-NH2) attached to a propylidene chain, contributing to its potential reactivity and biological activity. The presence of the double bond in the propylidene moiety suggests that it may participate in various chemical reactions, such as nucleophilic additions or substitutions. The compound's stereochemistry, indicated by the (5Z) configuration, implies specific spatial arrangements that can influence its interactions with biological targets. Additionally, the dihydro form of the dibenzo structure may affect its stability and solubility in different solvents. Overall, this compound's unique characteristics make it of interest in fields such as medicinal chemistry and materials science, where its properties can be explored for various applications.
Formula:C18H19NO
InChI:InChI=1/C18H19NO/c19-11-5-10-15-14-7-2-1-6-13(14)12-18(20)17-9-4-3-8-16(15)17/h1-4,6-10,18,20H,5,11-12,19H2/b15-10-
SMILES:c1ccc2c(c1)CC(c1ccccc1/C/2=C\CCN)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
(E/Z)-10-Hydroxydemethylnortriptyline Hydrochloride
CAS:Controlled ProductApplications (E/Z)-10-Hydroxydemethylnortriptyline Hydrochloride is a metabolite of Amitriptyline (A633350), which is an antidepressant drug.
References Borga, O., Garle, M.: J. Chromatogr., 68, 77 (1972); Tobe, A., et al.: Arzneim.-Forsch., 31, 1278 (1981); Mellstroem, B., et al.: Clin. Pharmacol. Ther., 34, 516 (1983);Formula:C18H19NO·(HCl)Color and Shape:NeatMolecular weight:301.81cis-10-Hydroxy-desmethylnortriptyline Hydrochloride
CAS:Controlled ProductApplications cis-10-Hydroxy-desmethylnortriptyline Hydrochloride is a metabolite of Amitriptyline (A633350), which is an antidepressant drug.
References Borga, O., Garle, M.: J. Chromatogr., 68, 77 (1972); Tobe, A., et al.: Arzneim.-Forsch., 31, 1278 (1981); Mellstroem, B., et al.: Clin. Pharmacol. Ther., 34, 516 (1983);Formula:C18H19NO·(HCl)Color and Shape:NeatMolecular weight:301.81
